About 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine
2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine (PubChem CID 87526136) has the molecular formula C20H32N2
and a molecular weight of 300.49 g/mol. Its IUPAC name is 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine |
| PubChem CID | 87526136 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine |
| SMILES | CCc1c(C2CCCCC2)cc(N)c(C2CCCCC2)c1N |
| InChI | InChI=1S/C20H32N2/c1-2-16-17(14-9-5-3-6-10-14)13-18(21)19(20(16)22)15-11-7-4-8-12-15/h13-15H,2-12,21-22H2,1H3 |
| InChIKey | FSAACYGIEAFSBR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine?
The IUPAC name of 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine (CID 87526136) is 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine.
What is the SMILES notation for 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine?
The canonical SMILES for 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine is CCc1c(C2CCCCC2)cc(N)c(C2CCCCC2)c1N.
What is the InChIKey of 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine?
The InChIKey is FSAACYGIEAFSBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N2/c1-2-16-17(14-9-5-3-6-10-14)13-18(21)19(20(16)22)15-11-7-4-8-12-15/h13-15H,2-12,21-22H2,1H3.
What are the key properties of 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine?
2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine has a molecular weight of 300.49 g/mol, XLogP of 5.51, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dicyclohexyl-4-ethylbenzene-1,3-diamine is sourced from PubChem (CID 87526136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).