C12H18N2 — CID 54013593
5-cyclopentyl-4-methylbenzene-1,3-diamine (PubChem CID 54013593) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-cyclopentyl-4-methylbenzene-1,3-diamine.
| Compound Name | 5-cyclopentyl-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 54013593 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 5-cyclopentyl-4-methylbenzene-1,3-diamine |
| SMILES | Cc1c(N)cc(N)cc1C1CCCC1 |
| InChI | InChI=1S/C12H18N2/c1-8-11(9-4-2-3-5-9)6-10(13)7-12(8)14/h6-7,9H,2-5,13-14H2,1H3 |
| InChIKey | KUBCMMZVQMYVRB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|