About 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane
2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane (PubChem CID 143930115) has the molecular formula C18H30F2O
and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane.
Molecular Properties
| Compound Name | 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane |
| PubChem CID | 143930115 |
| Molecular Formula | C18H30F2O |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane |
| SMILES | CC.CC(C)(C)CO.Cc1cc(F)c(C2CCC2)c(F)c1 |
| InChI | InChI=1S/C11H12F2.C5H12O.C2H6/c1-7-5-9(12)11(10(13)6-7)8-3-2-4-8;1-5(2,3)4-6;1-2/h5-6,8H,2-4H2,1H3;6H,4H2,1-3H3;1-2H3 |
| InChIKey | XDVDXCRUBIAFRJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane?
The IUPAC name of 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane (CID 143930115) is 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane.
What is the SMILES notation for 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane?
The canonical SMILES for 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane is CC.CC(C)(C)CO.Cc1cc(F)c(C2CCC2)c(F)c1.
What is the InChIKey of 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane?
The InChIKey is XDVDXCRUBIAFRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2.C5H12O.C2H6/c1-7-5-9(12)11(10(13)6-7)8-3-2-4-8;1-5(2,3)4-6;1-2/h5-6,8H,2-4H2,1H3;6H,4H2,1-3H3;1-2H3.
What are the key properties of 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane?
2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane has a molecular weight of 300.43 g/mol, XLogP of 5.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-1,3-difluoro-5-methylbenzene;2,2-dimethylpropan-1-ol;ethane is sourced from PubChem (CID 143930115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).