C19H32 — CID 167499683
1,3-ditert-butyl-2-cyclopropyl-5-methylbenzene;methane (PubChem CID 167499683) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-cyclopropyl-5-methylbenzene;methane.
| Compound Name | 1,3-ditert-butyl-2-cyclopropyl-5-methylbenzene;methane |
|---|---|
| PubChem CID | 167499683 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 1,3-ditert-butyl-2-cyclopropyl-5-methylbenzene;methane |
| SMILES | C.Cc1cc(C(C)(C)C)c(C2CC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H28.CH4/c1-12-10-14(17(2,3)4)16(13-8-9-13)15(11-12)18(5,6)7;/h10-11,13H,8-9H2,1-7H3;1H4 |
| InChIKey | QXSLWEOGPZBOEH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |