C17H26 — CID 155650846
1-tert-butyl-3-cyclohexyl-5-methylbenzene (PubChem CID 155650846) has the molecular formula C17H26 and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-tert-butyl-3-cyclohexyl-5-methylbenzene.
| Compound Name | 1-tert-butyl-3-cyclohexyl-5-methylbenzene |
|---|---|
| PubChem CID | 155650846 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1-tert-butyl-3-cyclohexyl-5-methylbenzene |
| SMILES | Cc1cc(C2CCCCC2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26/c1-13-10-15(14-8-6-5-7-9-14)12-16(11-13)17(2,3)4/h10-12,14H,5-9H2,1-4H3 |
| InChIKey | DDLQEMHPSBIBNO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |