C17H24 — CID 161279154
2-tert-butyl-1,3-dicyclopropyl-5-methylbenzene (PubChem CID 161279154) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dicyclopropyl-5-methylbenzene.
| Compound Name | 2-tert-butyl-1,3-dicyclopropyl-5-methylbenzene |
|---|---|
| PubChem CID | 161279154 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 2-tert-butyl-1,3-dicyclopropyl-5-methylbenzene |
| SMILES | Cc1cc(C2CC2)c(C(C)(C)C)c(C2CC2)c1 |
| InChI | InChI=1S/C17H24/c1-11-9-14(12-5-6-12)16(17(2,3)4)15(10-11)13-7-8-13/h9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | VEVQFDVCJRDVEG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |