C14H17F — CID 142950141
6-(2-fluoro-4,6-dimethylphenyl)bicyclo[3.1.0]hexane (PubChem CID 142950141) has the molecular formula C14H17F and a molecular weight of 204.29 g/mol. Its IUPAC name is 6-(2-fluoro-4,6-dimethylphenyl)bicyclo[3.1.0]hexane.
| Compound Name | 6-(2-fluoro-4,6-dimethylphenyl)bicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 142950141 |
| Molecular Formula | C14H17F |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 6-(2-fluoro-4,6-dimethylphenyl)bicyclo[3.1.0]hexane |
| SMILES | Cc1cc(C)c(C2C3CCCC32)c(F)c1 |
| InChI | InChI=1S/C14H17F/c1-8-6-9(2)13(12(15)7-8)14-10-4-3-5-11(10)14/h6-7,10-11,14H,3-5H2,1-2H3 |
| InChIKey | NYKJCZOCOYSOBZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |