C15H22FN — CID 106882846
2-(2-fluoro-4,6-dimethylphenyl)-4-methylcyclohexan-1-amine (PubChem CID 106882846) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-(2-fluoro-4,6-dimethylphenyl)-4-methylcyclohexan-1-amine.
| Compound Name | 2-(2-fluoro-4,6-dimethylphenyl)-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 106882846 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-(2-fluoro-4,6-dimethylphenyl)-4-methylcyclohexan-1-amine |
| SMILES | Cc1cc(C)c(C2CC(C)CCC2N)c(F)c1 |
| InChI | InChI=1S/C15H22FN/c1-9-4-5-14(17)12(7-9)15-11(3)6-10(2)8-13(15)16/h6,8-9,12,14H,4-5,7,17H2,1-3H3 |
| InChIKey | DPEWKAFHKOVNGC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |