C11H13F2N — CID 82827536
2-(2,6-difluoro-3-methylphenyl)cyclobutan-1-amine (PubChem CID 82827536) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-methylphenyl)cyclobutan-1-amine.
| Compound Name | 2-(2,6-difluoro-3-methylphenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 82827536 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-(2,6-difluoro-3-methylphenyl)cyclobutan-1-amine |
| SMILES | Cc1ccc(F)c(C2CCC2N)c1F |
| InChI | InChI=1S/C11H13F2N/c1-6-2-4-8(12)10(11(6)13)7-3-5-9(7)14/h2,4,7,9H,3,5,14H2,1H3 |
| InChIKey | QQWXRVNDVRJEAP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |