C17H25F2N — CID 82828508
[2-(2,6-difluoro-3-methylphenyl)-4-propylcyclohexyl]methanamine (PubChem CID 82828508) has the molecular formula C17H25F2N and a molecular weight of 281.39 g/mol. Its IUPAC name is [2-(2,6-difluoro-3-methylphenyl)-4-propylcyclohexyl]methanamine.
| Compound Name | [2-(2,6-difluoro-3-methylphenyl)-4-propylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 82828508 |
| Molecular Formula | C17H25F2N |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | [2-(2,6-difluoro-3-methylphenyl)-4-propylcyclohexyl]methanamine |
| SMILES | CCCC1CCC(CN)C(c2c(F)ccc(C)c2F)C1 |
| InChI | InChI=1S/C17H25F2N/c1-3-4-12-6-7-13(10-20)14(9-12)16-15(18)8-5-11(2)17(16)19/h5,8,12-14H,3-4,6-7,9-10,20H2,1-2H3 |
| InChIKey | XDDGUFGQLZASIC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |