C14H23NO — CID 81012027
[2-(furan-3-yl)-4-propylcyclohexyl]methanamine (PubChem CID 81012027) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is [2-(furan-3-yl)-4-propylcyclohexyl]methanamine.
| Compound Name | [2-(furan-3-yl)-4-propylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81012027 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | [2-(furan-3-yl)-4-propylcyclohexyl]methanamine |
| SMILES | CCCC1CCC(CN)C(c2ccoc2)C1 |
| InChI | InChI=1S/C14H23NO/c1-2-3-11-4-5-12(9-15)14(8-11)13-6-7-16-10-13/h6-7,10-12,14H,2-5,8-9,15H2,1H3 |
| InChIKey | SIEIHTFIMXRKDV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |