About 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine
8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 106880624) has the molecular formula C18H24FN
and a molecular weight of 273.39 g/mol. Its IUPAC name is 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine.
Molecular Properties
| Compound Name | 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine |
| PubChem CID | 106880624 |
| Molecular Formula | C18H24FN |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | Cc1cc(C)c(C2(N)CC3CC2C2CCCC32)c(F)c1 |
| InChI | InChI=1S/C18H24FN/c1-10-6-11(2)17(16(19)7-10)18(20)9-12-8-15(18)14-5-3-4-13(12)14/h6-7,12-15H,3-5,8-9,20H2,1-2H3 |
| InChIKey | ITHDWUUOGNVUNZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine (CID 106880624) is 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine is Cc1cc(C)c(C2(N)CC3CC2C2CCCC32)c(F)c1.
What is the InChIKey of 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is ITHDWUUOGNVUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24FN/c1-10-6-11(2)17(16(19)7-10)18(20)9-12-8-15(18)14-5-3-4-13(12)14/h6-7,12-15H,3-5,8-9,20H2,1-2H3.
What are the key properties of 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine?
8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 273.39 g/mol, XLogP of 4.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-fluoro-4,6-dimethylphenyl)tricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 106880624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).