C17H21F2N — CID 114931211
8-[(2,6-difluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 114931211) has the molecular formula C17H21F2N and a molecular weight of 277.36 g/mol. Its IUPAC name is 8-[(2,6-difluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | 8-[(2,6-difluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 114931211 |
| Molecular Formula | C17H21F2N |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 8-[(2,6-difluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | NC1(Cc2c(F)cccc2F)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H21F2N/c18-15-5-2-6-16(19)13(15)9-17(20)8-10-7-14(17)12-4-1-3-11(10)12/h2,5-6,10-12,14H,1,3-4,7-9,20H2 |
| InChIKey | UGJWZAXIIQMAJU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |