C17H22ClN — CID 60798618
8-[(4-chlorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 60798618) has the molecular formula C17H22ClN and a molecular weight of 275.82 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | 8-[(4-chlorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 60798618 |
| Molecular Formula | C17H22ClN |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 8-[(4-chlorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | NC1(Cc2ccc(Cl)cc2)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H22ClN/c18-13-6-4-11(5-7-13)9-17(19)10-12-8-16(17)15-3-1-2-14(12)15/h4-7,12,14-16H,1-3,8-10,19H2 |
| InChIKey | LSWBUEBDCFZRLV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |