C16H21BrN2 — CID 104802748
8-[(5-bromo-3-pyridinyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 104802748) has the molecular formula C16H21BrN2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 8-[(5-bromo-3-pyridinyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | 8-[(5-bromo-3-pyridinyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 104802748 |
| Molecular Formula | C16H21BrN2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 8-[(5-bromo-3-pyridinyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | NC1(Cc2cncc(Br)c2)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C16H21BrN2/c17-12-4-10(8-19-9-12)6-16(18)7-11-5-15(16)14-3-1-2-13(11)14/h4,8-9,11,13-15H,1-3,5-7,18H2 |
| InChIKey | IDQGOZLZRWCZEU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |