About 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine
8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 55028623) has the molecular formula C17H22FN
and a molecular weight of 259.37 g/mol. Its IUPAC name is 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
Molecular Properties
| Compound Name | 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| PubChem CID | 55028623 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | NC1(Cc2cccc(F)c2)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H22FN/c18-13-4-1-3-11(7-13)9-17(19)10-12-8-16(17)15-6-2-5-14(12)15/h1,3-4,7,12,14-16H,2,5-6,8-10,19H2 |
| InChIKey | QWNQDDRQZWCZQP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (CID 55028623) is 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine is NC1(Cc2cccc(F)c2)CC2CC1C1CCCC21.
What is the InChIKey of 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is QWNQDDRQZWCZQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22FN/c18-13-4-1-3-11(7-13)9-17(19)10-12-8-16(17)15-6-2-5-14(12)15/h1,3-4,7,12,14-16H,2,5-6,8-10,19H2.
What are the key properties of 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 259.37 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 55028623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).