C17H21FO — CID 60799336
8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-ol (PubChem CID 60799336) has the molecular formula C17H21FO and a molecular weight of 260.35 g/mol. Its IUPAC name is 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-ol.
| Compound Name | 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-ol |
|---|---|
| PubChem CID | 60799336 |
| Molecular Formula | C17H21FO |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 8-[(3-fluorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-ol |
| SMILES | OC1(Cc2cccc(F)c2)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H21FO/c18-13-4-1-3-11(7-13)9-17(19)10-12-8-16(17)15-6-2-5-14(12)15/h1,3-4,7,12,14-16,19H,2,5-6,8-10H2 |
| InChIKey | LTIURMUFHIUDRO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |