About 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine
8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 115002008) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine.
Analyze 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine (CID 115002008) is 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine is CC(C)OCCC1(N)CC2CC1C1CCCC21.
What is the InChIKey of 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is DPYCJEYOUVKBJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO/c1-10(2)17-7-6-15(16)9-11-8-14(15)13-5-3-4-12(11)13/h10-14H,3-9,16H2,1-2H3.
What are the key properties of 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine?
8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 237.39 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-propan-2-yloxyethyl)tricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 115002008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).