C18H31N — CID 55251575
8-(2-ethylcyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 55251575) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 8-(2-ethylcyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | 8-(2-ethylcyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 55251575 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 8-(2-ethylcyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | CCC1CCCCC1C1(N)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C18H31N/c1-2-12-6-3-4-9-16(12)18(19)11-13-10-17(18)15-8-5-7-14(13)15/h12-17H,2-11,19H2,1H3 |
| InChIKey | QSULXYSLUHZPGP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |