About 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde
8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde (PubChem CID 54499262) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde.
Molecular Properties
| Compound Name | 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde |
| PubChem CID | 54499262 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde |
| SMILES | CCC1(C=O)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C13H20O/c1-2-13(8-14)7-9-6-12(13)11-5-3-4-10(9)11/h8-12H,2-7H2,1H3 |
| InChIKey | YBHDOFISPLMFBM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde?
The IUPAC name of 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde (CID 54499262) is 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde.
What is the SMILES notation for 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde?
The canonical SMILES for 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde is CCC1(C=O)CC2CC1C1CCCC21.
What is the InChIKey of 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde?
The InChIKey is YBHDOFISPLMFBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-2-13(8-14)7-9-6-12(13)11-5-3-4-10(9)11/h8-12H,2-7H2,1H3.
What are the key properties of 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde?
8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde has a molecular weight of 192.30 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde is sourced from PubChem (CID 54499262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).