C13H20O — CID 54499262
8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde (PubChem CID 54499262) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde.
| Compound Name | 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde |
|---|---|
| PubChem CID | 54499262 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 8-ethyltricyclo[5.2.1.02,6]decane-8-carbaldehyde |
| SMILES | CCC1(C=O)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C13H20O/c1-2-13(8-14)7-9-6-12(13)11-5-3-4-10(9)11/h8-12H,2-7H2,1H3 |
| InChIKey | YBHDOFISPLMFBM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|