C12H20O — CID 13386822
8-ethyltricyclo[5.2.1.02,6]decan-8-ol (PubChem CID 13386822) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 8-ethyltricyclo[5.2.1.02,6]decan-8-ol.
| Compound Name | 8-ethyltricyclo[5.2.1.02,6]decan-8-ol |
|---|---|
| PubChem CID | 13386822 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 8-ethyltricyclo[5.2.1.02,6]decan-8-ol |
| SMILES | CCC1(O)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C12H20O/c1-2-12(13)7-8-6-11(12)10-5-3-4-9(8)10/h8-11,13H,2-7H2,1H3 |
| InChIKey | BYPKOASIGJWCPQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |