C14H23N — CID 163947971
3-ethyl-3-methylspiro[aziridine-2,8'-tricyclo[5.2.1.02,6]decane] (PubChem CID 163947971) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 3-ethyl-3-methylspiro[aziridine-2,8'-tricyclo[5.2.1.02,6]decane].
| Compound Name | 3-ethyl-3-methylspiro[aziridine-2,8'-tricyclo[5.2.1.02,6]decane] |
|---|---|
| PubChem CID | 163947971 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 3-ethyl-3-methylspiro[aziridine-2,8'-tricyclo[5.2.1.02,6]decane] |
| SMILES | CCC1(C)NC12CC1CC2C2CCCC12 |
| InChI | InChI=1S/C14H23N/c1-3-13(2)14(15-13)8-9-7-12(14)11-6-4-5-10(9)11/h9-12,15H,3-8H2,1-2H3 |
| InChIKey | RWVAUYUNWZCNEW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|