C15H22FN — CID 106880613
1-(2-fluoro-4,6-dimethylphenyl)-3-methylcyclohexan-1-amine (PubChem CID 106880613) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)-3-methylcyclohexan-1-amine.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 106880613 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)-3-methylcyclohexan-1-amine |
| SMILES | Cc1cc(C)c(C2(N)CCCC(C)C2)c(F)c1 |
| InChI | InChI=1S/C15H22FN/c1-10-5-4-6-15(17,9-10)14-12(3)7-11(2)8-13(14)16/h7-8,10H,4-6,9,17H2,1-3H3 |
| InChIKey | ZPZHZWFWNVUHRV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |