C11H14FN — CID 84767931
1-(2-fluoro-4,6-dimethylphenyl)cyclopropan-1-amine (PubChem CID 84767931) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)cyclopropan-1-amine.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 84767931 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)cyclopropan-1-amine |
| SMILES | Cc1cc(C)c(C2(N)CC2)c(F)c1 |
| InChI | InChI=1S/C11H14FN/c1-7-5-8(2)10(9(12)6-7)11(13)3-4-11/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | FZBYHWCORVQPRL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |