C12H15FOS — CID 106880466
3-(2-fluoro-4,6-dimethylphenyl)thiolan-3-ol (PubChem CID 106880466) has the molecular formula C12H15FOS and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(2-fluoro-4,6-dimethylphenyl)thiolan-3-ol.
| Compound Name | 3-(2-fluoro-4,6-dimethylphenyl)thiolan-3-ol |
|---|---|
| PubChem CID | 106880466 |
| Molecular Formula | C12H15FOS |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-(2-fluoro-4,6-dimethylphenyl)thiolan-3-ol |
| SMILES | Cc1cc(C)c(C2(O)CCSC2)c(F)c1 |
| InChI | InChI=1S/C12H15FOS/c1-8-5-9(2)11(10(13)6-8)12(14)3-4-15-7-12/h5-6,14H,3-4,7H2,1-2H3 |
| InChIKey | RWAXXXSIVUKRPS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |