C14H20FN — CID 106881701
2-ethyl-2-(2-fluoro-4,6-dimethylphenyl)pyrrolidine (PubChem CID 106881701) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-ethyl-2-(2-fluoro-4,6-dimethylphenyl)pyrrolidine.
| Compound Name | 2-ethyl-2-(2-fluoro-4,6-dimethylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 106881701 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2-ethyl-2-(2-fluoro-4,6-dimethylphenyl)pyrrolidine |
| SMILES | CCC1(c2c(C)cc(C)cc2F)CCCN1 |
| InChI | InChI=1S/C14H20FN/c1-4-14(6-5-7-16-14)13-11(3)8-10(2)9-12(13)15/h8-9,16H,4-7H2,1-3H3 |
| InChIKey | YSLNIRYUEKWCQI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |