C12H14F2 — CID 176962607
2-(1-ethylcyclopropyl)-1,5-difluoro-3-methylbenzene (PubChem CID 176962607) has the molecular formula C12H14F2 and a molecular weight of 196.24 g/mol. Its IUPAC name is 2-(1-ethylcyclopropyl)-1,5-difluoro-3-methylbenzene.
| Compound Name | 2-(1-ethylcyclopropyl)-1,5-difluoro-3-methylbenzene |
|---|---|
| PubChem CID | 176962607 |
| Molecular Formula | C12H14F2 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-(1-ethylcyclopropyl)-1,5-difluoro-3-methylbenzene |
| SMILES | CCC1(c2c(C)cc(F)cc2F)CC1 |
| InChI | InChI=1S/C12H14F2/c1-3-12(4-5-12)11-8(2)6-9(13)7-10(11)14/h6-7H,3-5H2,1-2H3 |
| InChIKey | JKVOHBVJLLYPOH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |