C11H11F2N — CID 59422472
4,6-difluoro-2,3,3-trimethylindole (PubChem CID 59422472) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is 4,6-difluoro-2,3,3-trimethylindole.
| Compound Name | 4,6-difluoro-2,3,3-trimethylindole |
|---|---|
| PubChem CID | 59422472 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4,6-difluoro-2,3,3-trimethylindole |
| SMILES | CC1=Nc2cc(F)cc(F)c2C1(C)C |
| InChI | InChI=1S/C11H11F2N/c1-6-11(2,3)10-8(13)4-7(12)5-9(10)14-6/h4-5H,1-3H3 |
| InChIKey | LWDDHYAWPUFCFB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |