C11H16F2 — CID 142885639
ethane;2-ethyl-1,5-difluoro-3-methylbenzene (PubChem CID 142885639) has the molecular formula C11H16F2 and a molecular weight of 186.24 g/mol. Its IUPAC name is ethane;2-ethyl-1,5-difluoro-3-methylbenzene.
| Compound Name | ethane;2-ethyl-1,5-difluoro-3-methylbenzene |
|---|---|
| PubChem CID | 142885639 |
| Molecular Formula | C11H16F2 |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | ethane;2-ethyl-1,5-difluoro-3-methylbenzene |
| SMILES | CC.CCc1c(C)cc(F)cc1F |
| InChI | InChI=1S/C9H10F2.C2H6/c1-3-8-6(2)4-7(10)5-9(8)11;1-2/h4-5H,3H2,1-2H3;1-2H3 |
| InChIKey | QVGGIDHNRKLDQR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |