C34H57F2N3 — CID 142169688
2-ethyl-1,5-difluoro-3-methylbenzene;4-ethylpyridin-2-amine;N,N,3-tripropyl-2-propylidenehexan-1-amine (PubChem CID 142169688) has the molecular formula C34H57F2N3 and a molecular weight of 545.85 g/mol. Its IUPAC name is 2-ethyl-1,5-difluoro-3-methylbenzene;4-ethylpyridin-2-amine;N,N,3-tripropyl-2-propylidenehexan-1-amine.
| Compound Name | 2-ethyl-1,5-difluoro-3-methylbenzene;4-ethylpyridin-2-amine;N,N,3-tripropyl-2-propylidenehexan-1-amine |
|---|---|
| PubChem CID | 142169688 |
| Molecular Formula | C34H57F2N3 |
| Molecular Weight | 545.85 g/mol |
| Exact Mass | 545.45 |
| IUPAC Name | 2-ethyl-1,5-difluoro-3-methylbenzene;4-ethylpyridin-2-amine;N,N,3-tripropyl-2-propylidenehexan-1-amine |
| SMILES | CCC=C(CN(CCC)CCC)C(CCC)CCC.CCc1c(C)cc(F)cc1F.CCc1ccnc(N)c1 |
| InChI | InChI=1S/C18H37N.C9H10F2.C7H10N2/c1-6-11-17(12-7-2)18(13-8-3)16-19(14-9-4)15-10-5;1-3-8-6(2)4-7(10)5-9(8)11;1-2-6-3-4-9-7(8)5-6/h13,17H,6-12,14-16H2,1-5H3;4-5H,3H2,1-2H3;3-5H,2H2,1H3,(H2,8,9) |
| InChIKey | WSRPIPAGTSAWDV-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.85 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|