C10H14FN — CID 55253918
2-(4-fluoro-2,6-dimethylphenyl)ethanamine (PubChem CID 55253918) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is 2-(4-fluoro-2,6-dimethylphenyl)ethanamine.
| Compound Name | 2-(4-fluoro-2,6-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 55253918 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-(4-fluoro-2,6-dimethylphenyl)ethanamine |
| SMILES | Cc1cc(F)cc(C)c1CCN |
| InChI | InChI=1S/C10H14FN/c1-7-5-9(11)6-8(2)10(7)3-4-12/h5-6H,3-4,12H2,1-2H3 |
| InChIKey | JRAJZXHILZJBBS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |