C9H11FS — CID 178171119
(4-fluoro-2,6-dimethylphenyl)methanethiol (PubChem CID 178171119) has the molecular formula C9H11FS and a molecular weight of 170.25 g/mol. Its IUPAC name is (4-fluoro-2,6-dimethylphenyl)methanethiol.
| Compound Name | (4-fluoro-2,6-dimethylphenyl)methanethiol |
|---|---|
| PubChem CID | 178171119 |
| Molecular Formula | C9H11FS |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (4-fluoro-2,6-dimethylphenyl)methanethiol |
| SMILES | Cc1cc(F)cc(C)c1CS |
| InChI | InChI=1S/C9H11FS/c1-6-3-8(10)4-7(2)9(6)5-11/h3-4,11H,5H2,1-2H3 |
| InChIKey | SXFICBPQVVQZHB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|