C10H14S2 — CID 10012981
[3,5-dimethyl-4-(sulfanylmethyl)phenyl]methanethiol (PubChem CID 10012981) has the molecular formula C10H14S2 and a molecular weight of 198.36 g/mol. Its IUPAC name is [3,5-dimethyl-4-(sulfanylmethyl)phenyl]methanethiol.
| Compound Name | [3,5-dimethyl-4-(sulfanylmethyl)phenyl]methanethiol |
|---|---|
| PubChem CID | 10012981 |
| Molecular Formula | C10H14S2 |
| Molecular Weight | 198.36 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | [3,5-dimethyl-4-(sulfanylmethyl)phenyl]methanethiol |
| SMILES | Cc1cc(CS)cc(C)c1CS |
| InChI | InChI=1S/C10H14S2/c1-7-3-9(5-11)4-8(2)10(7)6-12/h3-4,11-12H,5-6H2,1-2H3 |
| InChIKey | HMHJLUHJNCLQQS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|