C14H23FO — CID 143347734
ethane;2,3,4-triethyl-5-fluorophenol (PubChem CID 143347734) has the molecular formula C14H23FO and a molecular weight of 226.33 g/mol. Its IUPAC name is ethane;2,3,4-triethyl-5-fluorophenol.
| Compound Name | ethane;2,3,4-triethyl-5-fluorophenol |
|---|---|
| PubChem CID | 143347734 |
| Molecular Formula | C14H23FO |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | ethane;2,3,4-triethyl-5-fluorophenol |
| SMILES | CC.CCc1c(O)cc(F)c(CC)c1CC |
| InChI | InChI=1S/C12H17FO.C2H6/c1-4-8-9(5-2)11(13)7-12(14)10(8)6-3;1-2/h7,14H,4-6H2,1-3H3;1-2H3 |
| InChIKey | MBVYKNRZCFKGHS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |