C15H19FO2 — CID 176951343
ethane;4-ethyl-3-fluoro-5-methylnaphthalene-1,7-diol (PubChem CID 176951343) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is ethane;4-ethyl-3-fluoro-5-methylnaphthalene-1,7-diol.
| Compound Name | ethane;4-ethyl-3-fluoro-5-methylnaphthalene-1,7-diol |
|---|---|
| PubChem CID | 176951343 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | ethane;4-ethyl-3-fluoro-5-methylnaphthalene-1,7-diol |
| SMILES | CC.CCc1c(F)cc(O)c2cc(O)cc(C)c12 |
| InChI | InChI=1S/C13H13FO2.C2H6/c1-3-9-11(14)6-12(16)10-5-8(15)4-7(2)13(9)10;1-2/h4-6,15-16H,3H2,1-2H3;1-2H3 |
| InChIKey | UOPJFNNPBMTTSE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |