C13H13F2N — CID 178101910
5-ethyl-6,8-difluoro-4-methylnaphthalen-2-amine (PubChem CID 178101910) has the molecular formula C13H13F2N and a molecular weight of 221.25 g/mol. Its IUPAC name is 5-ethyl-6,8-difluoro-4-methylnaphthalen-2-amine.
| Compound Name | 5-ethyl-6,8-difluoro-4-methylnaphthalen-2-amine |
|---|---|
| PubChem CID | 178101910 |
| Molecular Formula | C13H13F2N |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-ethyl-6,8-difluoro-4-methylnaphthalen-2-amine |
| SMILES | CCc1c(F)cc(F)c2cc(N)cc(C)c12 |
| InChI | InChI=1S/C13H13F2N/c1-3-9-11(14)6-12(15)10-5-8(16)4-7(2)13(9)10/h4-6H,3,16H2,1-2H3 |
| InChIKey | FYGUAKDVIDIGHM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|