C15H20F3N — CID 176951368
ethane;5,6,8-trifluoro-4-methylnaphthalen-2-amine (PubChem CID 176951368) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is ethane;5,6,8-trifluoro-4-methylnaphthalen-2-amine.
| Compound Name | ethane;5,6,8-trifluoro-4-methylnaphthalen-2-amine |
|---|---|
| PubChem CID | 176951368 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | ethane;5,6,8-trifluoro-4-methylnaphthalen-2-amine |
| SMILES | CC.CC.Cc1cc(N)cc2c(F)cc(F)c(F)c12 |
| InChI | InChI=1S/C11H8F3N.2C2H6/c1-5-2-6(15)3-7-8(12)4-9(13)11(14)10(5)7;2*1-2/h2-4H,15H2,1H3;2*1-2H3 |
| InChIKey | LSROUORILXQAHP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|