C11H16F2O — CID 169134909
ethane;1-ethoxy-3,5-difluoro-2-methylbenzene (PubChem CID 169134909) has the molecular formula C11H16F2O and a molecular weight of 202.24 g/mol. Its IUPAC name is ethane;1-ethoxy-3,5-difluoro-2-methylbenzene.
| Compound Name | ethane;1-ethoxy-3,5-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 169134909 |
| Molecular Formula | C11H16F2O |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | ethane;1-ethoxy-3,5-difluoro-2-methylbenzene |
| SMILES | CC.CCOc1cc(F)cc(F)c1C |
| InChI | InChI=1S/C9H10F2O.C2H6/c1-3-12-9-5-7(10)4-8(11)6(9)2;1-2/h4-5H,3H2,1-2H3;1-2H3 |
| InChIKey | BEKUVVPYUXNGSC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |