C11H16F2O2 — CID 169135247
2-(3,5-difluoro-2-methylphenoxy)ethanol;ethane (PubChem CID 169135247) has the molecular formula C11H16F2O2 and a molecular weight of 218.24 g/mol. Its IUPAC name is 2-(3,5-difluoro-2-methylphenoxy)ethanol;ethane.
| Compound Name | 2-(3,5-difluoro-2-methylphenoxy)ethanol;ethane |
|---|---|
| PubChem CID | 169135247 |
| Molecular Formula | C11H16F2O2 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-(3,5-difluoro-2-methylphenoxy)ethanol;ethane |
| SMILES | CC.Cc1c(F)cc(F)cc1OCCO |
| InChI | InChI=1S/C9H10F2O2.C2H6/c1-6-8(11)4-7(10)5-9(6)13-3-2-12;1-2/h4-5,12H,2-3H2,1H3;1-2H3 |
| InChIKey | GTAUQUHAUIDWDK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |