C14H7F3S — CID 19874672
2,4,7-trifluoro-5-methylfluorene-9-thione (PubChem CID 19874672) has the molecular formula C14H7F3S and a molecular weight of 264.27 g/mol. Its IUPAC name is 2,4,7-trifluoro-5-methylfluorene-9-thione.
| Compound Name | 2,4,7-trifluoro-5-methylfluorene-9-thione |
|---|---|
| PubChem CID | 19874672 |
| Molecular Formula | C14H7F3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2,4,7-trifluoro-5-methylfluorene-9-thione |
| SMILES | Cc1cc(F)cc2c1-c1c(F)cc(F)cc1C2=S |
| InChI | InChI=1S/C14H7F3S/c1-6-2-7(15)3-9-12(6)13-10(14(9)18)4-8(16)5-11(13)17/h2-5H,1H3 |
| InChIKey | NEIWAGCOLUKYPO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|