C9H5F3N2O — CID 146811154
3-methyl-5-(2,4,6-trifluorophenyl)-1,2,4-oxadiazole (PubChem CID 146811154) has the molecular formula C9H5F3N2O and a molecular weight of 214.15 g/mol. Its IUPAC name is 3-methyl-5-(2,4,6-trifluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-methyl-5-(2,4,6-trifluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 146811154 |
| Molecular Formula | C9H5F3N2O |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 3-methyl-5-(2,4,6-trifluorophenyl)-1,2,4-oxadiazole |
| SMILES | Cc1noc(-c2c(F)cc(F)cc2F)n1 |
| InChI | InChI=1S/C9H5F3N2O/c1-4-13-9(15-14-4)8-6(11)2-5(10)3-7(8)12/h2-3H,1H3 |
| InChIKey | SABZHASLOWKNMN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |