C14H7ClF2N2O — CID 2803952
3-(4-chlorophenyl)-5-(2,6-difluorophenyl)-1,2,4-oxadiazole (PubChem CID 2803952) has the molecular formula C14H7ClF2N2O and a molecular weight of 292.67 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-(2,6-difluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-chlorophenyl)-5-(2,6-difluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2803952 |
| Molecular Formula | C14H7ClF2N2O |
| Molecular Weight | 292.67 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-(4-chlorophenyl)-5-(2,6-difluorophenyl)-1,2,4-oxadiazole |
| SMILES | Fc1cccc(F)c1-c1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C14H7ClF2N2O/c15-9-6-4-8(5-7-9)13-18-14(20-19-13)12-10(16)2-1-3-11(12)17/h1-7H |
| InChIKey | YLPYJDPMAQJMAO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |