C14H15ClN2O — CID 741929
5-(4-chlorophenyl)-3-cyclohexyl-1,2,4-oxadiazole (PubChem CID 741929) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-cyclohexyl-1,2,4-oxadiazole.
| Compound Name | 5-(4-chlorophenyl)-3-cyclohexyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 741929 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 5-(4-chlorophenyl)-3-cyclohexyl-1,2,4-oxadiazole |
| SMILES | Clc1ccc(-c2nc(C3CCCCC3)no2)cc1 |
| InChI | InChI=1S/C14H15ClN2O/c15-12-8-6-11(7-9-12)14-16-13(17-18-14)10-4-2-1-3-5-10/h6-10H,1-5H2 |
| InChIKey | IPESGZGLXSYLIQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |