C8H7N3O — CID 2305446
5-phenyl-1,2,4-oxadiazol-3-amine (PubChem CID 2305446) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 5-phenyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-phenyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 2305446 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 5-phenyl-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C8H7N3O/c9-8-10-7(12-11-8)6-4-2-1-3-5-6/h1-5H,(H2,9,11) |
| InChIKey | WEDNOTOHJOGLIK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |