About 5-phenyl-1,2,4-oxadiazol-3-amine
5-phenyl-1,2,4-oxadiazol-3-amine (PubChem CID 2305446) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 5-phenyl-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-phenyl-1,2,4-oxadiazol-3-amine |
| PubChem CID | 2305446 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 5-phenyl-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C8H7N3O/c9-8-10-7(12-11-8)6-4-2-1-3-5-6/h1-5H,(H2,9,11) |
| InChIKey | WEDNOTOHJOGLIK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-phenyl-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-phenyl-1,2,4-oxadiazol-3-amine (CID 2305446) is 5-phenyl-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-phenyl-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-phenyl-1,2,4-oxadiazol-3-amine is Nc1noc(-c2ccccc2)n1.
What is the InChIKey of 5-phenyl-1,2,4-oxadiazol-3-amine?
The InChIKey is WEDNOTOHJOGLIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-8-10-7(12-11-8)6-4-2-1-3-5-6/h1-5H,(H2,9,11).
What are the key properties of 5-phenyl-1,2,4-oxadiazol-3-amine?
5-phenyl-1,2,4-oxadiazol-3-amine has a molecular weight of 161.16 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 2305446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).