C16H9F3O2S2 — CID 15037285
O-ethyl (2,5,7-trifluoro-9-oxofluoren-4-yl)sulfanylmethanethioate (PubChem CID 15037285) has the molecular formula C16H9F3O2S2 and a molecular weight of 354.37 g/mol. Its IUPAC name is O-ethyl (2,5,7-trifluoro-9-oxofluoren-4-yl)sulfanylmethanethioate.
| Compound Name | O-ethyl (2,5,7-trifluoro-9-oxofluoren-4-yl)sulfanylmethanethioate |
|---|---|
| PubChem CID | 15037285 |
| Molecular Formula | C16H9F3O2S2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | O-ethyl (2,5,7-trifluoro-9-oxofluoren-4-yl)sulfanylmethanethioate |
| SMILES | CCOC(=S)Sc1cc(F)cc2c1-c1c(F)cc(F)cc1C2=O |
| InChI | InChI=1S/C16H9F3O2S2/c1-2-21-16(22)23-12-6-8(18)4-10-14(12)13-9(15(10)20)3-7(17)5-11(13)19/h3-6H,2H2,1H3 |
| InChIKey | QQPJLQDCMBKLMB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|