C17H24F2O2S2Si — CID 15863567
O-ethyl [5-(2,4-difluorophenyl)-5-oxo-1-trimethylsilylpentan-2-yl]sulfanylmethanethioate (PubChem CID 15863567) has the molecular formula C17H24F2O2S2Si and a molecular weight of 390.59 g/mol. Its IUPAC name is O-ethyl [5-(2,4-difluorophenyl)-5-oxo-1-trimethylsilylpentan-2-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [5-(2,4-difluorophenyl)-5-oxo-1-trimethylsilylpentan-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 15863567 |
| Molecular Formula | C17H24F2O2S2Si |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | O-ethyl [5-(2,4-difluorophenyl)-5-oxo-1-trimethylsilylpentan-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CCC(=O)c1ccc(F)cc1F)C[Si](C)(C)C |
| InChI | InChI=1S/C17H24F2O2S2Si/c1-5-21-17(22)23-13(11-24(2,3)4)7-9-16(20)14-8-6-12(18)10-15(14)19/h6,8,10,13H,5,7,9,11H2,1-4H3 |
| InChIKey | FYCZEZHENLGODM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|