C16H17F — CID 91665782
2-(5-fluoro-2-methylphenyl)-1,3,5-trimethylbenzene (PubChem CID 91665782) has the molecular formula C16H17F and a molecular weight of 228.31 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-1,3,5-trimethylbenzene.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 91665782 |
| Molecular Formula | C16H17F |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(-c2cc(F)ccc2C)c(C)c1 |
| InChI | InChI=1S/C16H17F/c1-10-7-12(3)16(13(4)8-10)15-9-14(17)6-5-11(15)2/h5-9H,1-4H3 |
| InChIKey | ZDOZZHNETSYDFM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |