C42H38F3PRuS+ — CID 177429030
2,6-bis(2,4,6-trimethylphenyl)benzenethiolate;ruthenium(1+);tris(4-fluorophenyl)phosphanium (PubChem CID 177429030) has the molecular formula C42H38F3PRuS+ and a molecular weight of 763.87 g/mol. Its IUPAC name is 2,6-bis(2,4,6-trimethylphenyl)benzenethiolate;ruthenium(1+);tris(4-fluorophenyl)phosphanium.
| Compound Name | 2,6-bis(2,4,6-trimethylphenyl)benzenethiolate;ruthenium(1+);tris(4-fluorophenyl)phosphanium |
|---|---|
| PubChem CID | 177429030 |
| Molecular Formula | C42H38F3PRuS+ |
| Molecular Weight | 763.87 g/mol |
| Exact Mass | 764.14 |
| IUPAC Name | 2,6-bis(2,4,6-trimethylphenyl)benzenethiolate;ruthenium(1+);tris(4-fluorophenyl)phosphanium |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[S-])c(C)c1.Fc1ccc([PH+](c2ccc(F)cc2)c2ccc(F)cc2)cc1.[Ru+] |
| InChI | InChI=1S/C24H26S.C18H12F3P.Ru/c1-14-10-16(3)22(17(4)11-14)20-8-7-9-21(24(20)25)23-18(5)12-15(2)13-19(23)6;19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18;/h7-13,25H,1-6H3;1-12H;/q;;+1 |
| InChIKey | LDZCWZRBKVGMTI-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.87 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|