4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid

C16H15FO3 — CID 106681044

IUPAC4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid
SMILESCOc1cc(C)cc(C)c1-c1cc(F)ccc1C(=O)O
InChIInChI=1S/C16H15FO3/c1-9-6-10(2)15(14(7-9)20-3)13-8-11(17)4-5-12(13)16(18)19/h4-8H,1-3H3,(H,18,19)
InChIKeyOFXWEKDUPHJHIT-UHFFFAOYSA-N
MW274.29 g/mol
LogP3.82
Rot. Bonds3

About 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid

4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid (PubChem CID 106681044) has the molecular formula C16H15FO3 and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid.

Molecular Properties

Compound Name4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid
PubChem CID106681044
Molecular FormulaC16H15FO3
Molecular Weight274.29 g/mol
Exact Mass274.10
IUPAC Name4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid
SMILESCOc1cc(C)cc(C)c1-c1cc(F)ccc1C(=O)O
InChIInChI=1S/C16H15FO3/c1-9-6-10(2)15(14(7-9)20-3)13-8-11(17)4-5-12(13)16(18)19/h4-8H,1-3H3,(H,18,19)
InChIKeyOFXWEKDUPHJHIT-UHFFFAOYSA-N
XLogP3.82
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.29
LogP ≤ 53.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid?
The IUPAC name of 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid (CID 106681044) is 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid.
What is the SMILES notation for 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid?
The canonical SMILES for 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid is COc1cc(C)cc(C)c1-c1cc(F)ccc1C(=O)O.
What is the InChIKey of 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid?
The InChIKey is OFXWEKDUPHJHIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FO3/c1-9-6-10(2)15(14(7-9)20-3)13-8-11(17)4-5-12(13)16(18)19/h4-8H,1-3H3,(H,18,19).
What are the key properties of 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid?
4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid has a molecular weight of 274.29 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid is sourced from PubChem (CID 106681044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).