C16H15FO3 — CID 106681044
4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid (PubChem CID 106681044) has the molecular formula C16H15FO3 and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid.
| Compound Name | 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid |
|---|---|
| PubChem CID | 106681044 |
| Molecular Formula | C16H15FO3 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-fluoro-2-(2-methoxy-4,6-dimethylphenyl)benzoic acid |
| SMILES | COc1cc(C)cc(C)c1-c1cc(F)ccc1C(=O)O |
| InChI | InChI=1S/C16H15FO3/c1-9-6-10(2)15(14(7-9)20-3)13-8-11(17)4-5-12(13)16(18)19/h4-8H,1-3H3,(H,18,19) |
| InChIKey | OFXWEKDUPHJHIT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |