About 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid
5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid (PubChem CID 106882408) has the molecular formula C13H16FNO2
and a molecular weight of 237.27 g/mol. Its IUPAC name is 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 106882408 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cc(C)c(C2CCC(C(=O)O)N2)c(F)c1 |
| InChI | InChI=1S/C13H16FNO2/c1-7-5-8(2)12(9(14)6-7)10-3-4-11(15-10)13(16)17/h5-6,10-11,15H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | HZWLGQOPSCWFNQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid (CID 106882408) is 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid is Cc1cc(C)c(C2CCC(C(=O)O)N2)c(F)c1.
What is the InChIKey of 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid?
The InChIKey is HZWLGQOPSCWFNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO2/c1-7-5-8(2)12(9(14)6-7)10-3-4-11(15-10)13(16)17/h5-6,10-11,15H,3-4H2,1-2H3,(H,16,17).
What are the key properties of 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid?
5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid has a molecular weight of 237.27 g/mol, XLogP of 2.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoro-4,6-dimethylphenyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 106882408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).